C34H63NO — CID 170128148
1-[3-[(2E)-3,5-dimethyltricosa-2,14,17-trien-5-yl]oxyheptyl]aziridine (PubChem CID 170128148) has the molecular formula C34H63NO and a molecular weight of 501.88 g/mol. Its IUPAC name is 1-[3-[(2E)-3,5-dimethyltricosa-2,14,17-trien-5-yl]oxyheptyl]aziridine.
| Compound Name | 1-[3-[(2E)-3,5-dimethyltricosa-2,14,17-trien-5-yl]oxyheptyl]aziridine |
|---|---|
| PubChem CID | 170128148 |
| Molecular Formula | C34H63NO |
| Molecular Weight | 501.88 g/mol |
| Exact Mass | 501.49 |
| IUPAC Name | 1-[3-[(2E)-3,5-dimethyltricosa-2,14,17-trien-5-yl]oxyheptyl]aziridine |
| SMILES | C/C=C(\C)CC(C)(CCCCCCCCC=CCC=CCCCCC)OC(CCCC)CCN1CC1 |
| InChI | InChI=1S/C34H63NO/c1-6-9-11-12-13-14-15-16-17-18-19-20-21-22-23-24-27-34(5,31-32(4)8-3)36-33(25-10-7-2)26-28-35-29-30-35/h8,13-14,16-17,33H,6-7,9-12,15,18-31H2,1-5H3/b14-13?,17-16?,32-8+ |
| InChIKey | XZLFSEXAYAWYQW-ZMZMZUPOSA-N |
| XLogP | 10.59 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.88 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|