C17H26F2N2 — CID 170128220
(3E,5E)-4-(cyclopropylmethyl)-6-(3,3-difluoropiperidin-4-yl)octa-1,3,5-trien-3-amine (PubChem CID 170128220) has the molecular formula C17H26F2N2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (3E,5E)-4-(cyclopropylmethyl)-6-(3,3-difluoropiperidin-4-yl)octa-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-4-(cyclopropylmethyl)-6-(3,3-difluoropiperidin-4-yl)octa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 170128220 |
| Molecular Formula | C17H26F2N2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | (3E,5E)-4-(cyclopropylmethyl)-6-(3,3-difluoropiperidin-4-yl)octa-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C(\C=C(/CC)C1CCNCC1(F)F)CC1CC1 |
| InChI | InChI=1S/C17H26F2N2/c1-3-13(15-7-8-21-11-17(15,18)19)10-14(16(20)4-2)9-12-5-6-12/h4,10,12,15,21H,2-3,5-9,11,20H2,1H3/b13-10+,16-14+ |
| InChIKey | ARCHVPPXOMUSKX-BMCDEEFISA-N |
| XLogP | 3.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|