About [2-amino-6-(1-methyl-1,2,4-triazol-3-yl)phenyl]methanol
[2-amino-6-(1-methyl-1,2,4-triazol-3-yl)phenyl]methanol (PubChem CID 170128515) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is [2-amino-6-(1-methyl-1,2,4-triazol-3-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [2-amino-6-(1-methyl-1,2,4-triazol-3-yl)phenyl]methanol |
| PubChem CID | 170128515 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | [2-amino-6-(1-methyl-1,2,4-triazol-3-yl)phenyl]methanol |
| SMILES | Cn1cnc(-c2cccc(N)c2CO)n1 |
| InChI | InChI=1S/C10H12N4O/c1-14-6-12-10(13-14)7-3-2-4-9(11)8(7)5-15/h2-4,6,15H,5,11H2,1H3 |
| InChIKey | JBJCSJRUBSSBKN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [2-amino-6-(1-methyl-1,2,4-triazol-3-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-amino-6-(1-methyl-1,2,4-triazol-3-yl)phenyl]methanol?
The IUPAC name of [2-amino-6-(1-methyl-1,2,4-triazol-3-yl)phenyl]methanol (CID 170128515) is [2-amino-6-(1-methyl-1,2,4-triazol-3-yl)phenyl]methanol.
What is the SMILES notation for [2-amino-6-(1-methyl-1,2,4-triazol-3-yl)phenyl]methanol?
The canonical SMILES for [2-amino-6-(1-methyl-1,2,4-triazol-3-yl)phenyl]methanol is Cn1cnc(-c2cccc(N)c2CO)n1.
What is the InChIKey of [2-amino-6-(1-methyl-1,2,4-triazol-3-yl)phenyl]methanol?
The InChIKey is JBJCSJRUBSSBKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-14-6-12-10(13-14)7-3-2-4-9(11)8(7)5-15/h2-4,6,15H,5,11H2,1H3.
What are the key properties of [2-amino-6-(1-methyl-1,2,4-triazol-3-yl)phenyl]methanol?
[2-amino-6-(1-methyl-1,2,4-triazol-3-yl)phenyl]methanol has a molecular weight of 204.23 g/mol, XLogP of 0.56, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-amino-6-(1-methyl-1,2,4-triazol-3-yl)phenyl]methanol is sourced from PubChem (CID 170128515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).