C27H31F3N7OP — CID 170129297
(20S,23S)-31-dimethylphosphoryl-28-(trifluoromethyl)-4,12,14,19,24,26,29-heptazahexacyclo[23.3.1.15,9.120,23.02,6.010,14]hentriaconta-1(29),2,5,7,9(31),10,12,25,27-nonaene (PubChem CID 170129297) has the molecular formula C27H31F3N7OP and a molecular weight of 557.56 g/mol. Its IUPAC name is (20S,23S)-31-dimethylphosphoryl-28-(trifluoromethyl)-4,12,14,19,24,26,29-heptazahexacyclo[23.3.1.15,9.120,23.02,6.010,14]hentriaconta-1(29),2,5,7,9(31),10,12,25,27-nonaene.
| Compound Name | (20S,23S)-31-dimethylphosphoryl-28-(trifluoromethyl)-4,12,14,19,24,26,29-heptazahexacyclo[23.3.1.15,9.120,23.02,6.010,14]hentriaconta-1(29),2,5,7,9(31),10,12,25,27-nonaene |
|---|---|
| PubChem CID | 170129297 |
| Molecular Formula | C27H31F3N7OP |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | (20S,23S)-31-dimethylphosphoryl-28-(trifluoromethyl)-4,12,14,19,24,26,29-heptazahexacyclo[23.3.1.15,9.120,23.02,6.010,14]hentriaconta-1(29),2,5,7,9(31),10,12,25,27-nonaene |
| SMILES | CP(C)(=O)c1c2ccc3c(c[nH]c13)-c1nc(ncc1C(F)(F)F)N[C@H]1CC[C@@H](C1)NCCCCn1cncc1-2 |
| InChI | InChI=1S/C27H31F3N7OP/c1-39(2,38)25-19-8-7-18-20(12-33-24(18)25)23-21(27(28,29)30)13-34-26(36-23)35-17-6-5-16(11-17)32-9-3-4-10-37-15-31-14-22(19)37/h7-8,12-17,32-33H,3-6,9-11H2,1-2H3,(H,34,35,36)/t16-,17-/m0/s1 |
| InChIKey | IFHIQHOXWZURCB-IRXDYDNUSA-N |
| XLogP | 5.47 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|