About N'-methyl-N-[(E)-3,3,3-trifluoroprop-1-enyl]carbamimidoyl chloride
N'-methyl-N-[(E)-3,3,3-trifluoroprop-1-enyl]carbamimidoyl chloride (PubChem CID 170129674) has the molecular formula C5H6ClF3N2
and a molecular weight of 186.56 g/mol. Its IUPAC name is N'-methyl-N-[(E)-3,3,3-trifluoroprop-1-enyl]carbamimidoyl chloride.
Molecular Properties
| Compound Name | N'-methyl-N-[(E)-3,3,3-trifluoroprop-1-enyl]carbamimidoyl chloride |
| PubChem CID | 170129674 |
| Molecular Formula | C5H6ClF3N2 |
| Molecular Weight | 186.56 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | N'-methyl-N-[(E)-3,3,3-trifluoroprop-1-enyl]carbamimidoyl chloride |
| SMILES | C/N=C(\Cl)N/C=C/C(F)(F)F |
| InChI | InChI=1S/C5H6ClF3N2/c1-10-4(6)11-3-2-5(7,8)9/h2-3H,1H3,(H,10,11)/b3-2+ |
| InChIKey | KSJPXOZJHTVOII-NSCUHMNNSA-N |
| XLogP | 1.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.56 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N-[(E)-3,3,3-trifluoroprop-1-enyl]carbamimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N-[(E)-3,3,3-trifluoroprop-1-enyl]carbamimidoyl chloride?
The IUPAC name of N'-methyl-N-[(E)-3,3,3-trifluoroprop-1-enyl]carbamimidoyl chloride (CID 170129674) is N'-methyl-N-[(E)-3,3,3-trifluoroprop-1-enyl]carbamimidoyl chloride.
What is the SMILES notation for N'-methyl-N-[(E)-3,3,3-trifluoroprop-1-enyl]carbamimidoyl chloride?
The canonical SMILES for N'-methyl-N-[(E)-3,3,3-trifluoroprop-1-enyl]carbamimidoyl chloride is C/N=C(\Cl)N/C=C/C(F)(F)F.
What is the InChIKey of N'-methyl-N-[(E)-3,3,3-trifluoroprop-1-enyl]carbamimidoyl chloride?
The InChIKey is KSJPXOZJHTVOII-NSCUHMNNSA-N. The full InChI is InChI=1S/C5H6ClF3N2/c1-10-4(6)11-3-2-5(7,8)9/h2-3H,1H3,(H,10,11)/b3-2+.
What are the key properties of N'-methyl-N-[(E)-3,3,3-trifluoroprop-1-enyl]carbamimidoyl chloride?
N'-methyl-N-[(E)-3,3,3-trifluoroprop-1-enyl]carbamimidoyl chloride has a molecular weight of 186.56 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N-[(E)-3,3,3-trifluoroprop-1-enyl]carbamimidoyl chloride is sourced from PubChem (CID 170129674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).