C10H21F2N5 — CID 170129958
2-[(1S,3S)-3-[(4-amino-3,3-difluorobutyl)amino]cyclopentyl]guanidine (PubChem CID 170129958) has the molecular formula C10H21F2N5 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-[(1S,3S)-3-[(4-amino-3,3-difluorobutyl)amino]cyclopentyl]guanidine.
| Compound Name | 2-[(1S,3S)-3-[(4-amino-3,3-difluorobutyl)amino]cyclopentyl]guanidine |
|---|---|
| PubChem CID | 170129958 |
| Molecular Formula | C10H21F2N5 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 2-[(1S,3S)-3-[(4-amino-3,3-difluorobutyl)amino]cyclopentyl]guanidine |
| SMILES | NCC(F)(F)CCN[C@H]1CC[C@H](N=C(N)N)C1 |
| InChI | InChI=1S/C10H21F2N5/c11-10(12,6-13)3-4-16-7-1-2-8(5-7)17-9(14)15/h7-8,16H,1-6,13H2,(H4,14,15,17)/t7-,8-/m0/s1 |
| InChIKey | UCFJSSTYCIGWGC-YUMQZZPRSA-N |
| XLogP | -0.25 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|