About cyclohexa-1,3-dien-1-yl-[4-(4-phenyldiazenylphenyl)phenyl]diazene
cyclohexa-1,3-dien-1-yl-[4-(4-phenyldiazenylphenyl)phenyl]diazene (PubChem CID 170130172) has the molecular formula C24H20N4
and a molecular weight of 364.45 g/mol. Its IUPAC name is cyclohexa-1,3-dien-1-yl-[4-(4-phenyldiazenylphenyl)phenyl]diazene.
Molecular Properties
| Compound Name | cyclohexa-1,3-dien-1-yl-[4-(4-phenyldiazenylphenyl)phenyl]diazene |
| PubChem CID | 170130172 |
| Molecular Formula | C24H20N4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | cyclohexa-1,3-dien-1-yl-[4-(4-phenyldiazenylphenyl)phenyl]diazene |
| SMILES | C1=CCCC(/N=N/c2ccc(-c3ccc(/N=N/c4ccccc4)cc3)cc2)=C1 |
| InChI | InChI=1S/C24H20N4/c1-3-7-21(8-4-1)25-27-23-15-11-19(12-16-23)20-13-17-24(18-14-20)28-26-22-9-5-2-6-10-22/h1-5,7-9,11-18H,6,10H2/b27-25+,28-26+ |
| InChIKey | XXKNBMYTUGUISY-NBHCHVEOSA-N |
| XLogP | 8.09 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-1,3-dien-1-yl-[4-(4-phenyldiazenylphenyl)phenyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,3-dien-1-yl-[4-(4-phenyldiazenylphenyl)phenyl]diazene?
The IUPAC name of cyclohexa-1,3-dien-1-yl-[4-(4-phenyldiazenylphenyl)phenyl]diazene (CID 170130172) is cyclohexa-1,3-dien-1-yl-[4-(4-phenyldiazenylphenyl)phenyl]diazene.
What is the SMILES notation for cyclohexa-1,3-dien-1-yl-[4-(4-phenyldiazenylphenyl)phenyl]diazene?
The canonical SMILES for cyclohexa-1,3-dien-1-yl-[4-(4-phenyldiazenylphenyl)phenyl]diazene is C1=CCCC(/N=N/c2ccc(-c3ccc(/N=N/c4ccccc4)cc3)cc2)=C1.
What is the InChIKey of cyclohexa-1,3-dien-1-yl-[4-(4-phenyldiazenylphenyl)phenyl]diazene?
The InChIKey is XXKNBMYTUGUISY-NBHCHVEOSA-N. The full InChI is InChI=1S/C24H20N4/c1-3-7-21(8-4-1)25-27-23-15-11-19(12-16-23)20-13-17-24(18-14-20)28-26-22-9-5-2-6-10-22/h1-5,7-9,11-18H,6,10H2/b27-25+,28-26+.
What are the key properties of cyclohexa-1,3-dien-1-yl-[4-(4-phenyldiazenylphenyl)phenyl]diazene?
cyclohexa-1,3-dien-1-yl-[4-(4-phenyldiazenylphenyl)phenyl]diazene has a molecular weight of 364.45 g/mol, XLogP of 8.09, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,3-dien-1-yl-[4-(4-phenyldiazenylphenyl)phenyl]diazene is sourced from PubChem (CID 170130172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).