C12H25F2N5 — CID 170130350
1-[(1S,3S)-3-[[3,3-difluoro-4-(methylamino)butyl]amino]cyclopentyl]-2-methylguanidine (PubChem CID 170130350) has the molecular formula C12H25F2N5 and a molecular weight of 277.36 g/mol. Its IUPAC name is 1-[(1S,3S)-3-[[3,3-difluoro-4-(methylamino)butyl]amino]cyclopentyl]-2-methylguanidine.
| Compound Name | 1-[(1S,3S)-3-[[3,3-difluoro-4-(methylamino)butyl]amino]cyclopentyl]-2-methylguanidine |
|---|---|
| PubChem CID | 170130350 |
| Molecular Formula | C12H25F2N5 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.21 |
| IUPAC Name | 1-[(1S,3S)-3-[[3,3-difluoro-4-(methylamino)butyl]amino]cyclopentyl]-2-methylguanidine |
| SMILES | C/N=C(\N)N[C@H]1CC[C@H](NCCC(F)(F)CNC)C1 |
| InChI | InChI=1S/C12H25F2N5/c1-16-8-12(13,14)5-6-18-9-3-4-10(7-9)19-11(15)17-2/h9-10,16,18H,3-8H2,1-2H3,(H3,15,17,19)/t9-,10-/m0/s1 |
| InChIKey | ZLWSWGFQPRMXIK-UWVGGRQHSA-N |
| XLogP | 0.28 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|