About (Z)-4-bromo-N-ethenyl-5,5-dimethylhept-3-en-3-amine
(Z)-4-bromo-N-ethenyl-5,5-dimethylhept-3-en-3-amine (PubChem CID 170130567) has the molecular formula C11H20BrN
and a molecular weight of 246.19 g/mol. Its IUPAC name is (Z)-4-bromo-N-ethenyl-5,5-dimethylhept-3-en-3-amine.
Molecular Properties
| Compound Name | (Z)-4-bromo-N-ethenyl-5,5-dimethylhept-3-en-3-amine |
| PubChem CID | 170130567 |
| Molecular Formula | C11H20BrN |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | (Z)-4-bromo-N-ethenyl-5,5-dimethylhept-3-en-3-amine |
| SMILES | C=CN/C(CC)=C(\Br)C(C)(C)CC |
| InChI | InChI=1S/C11H20BrN/c1-6-9(13-8-3)10(12)11(4,5)7-2/h8,13H,3,6-7H2,1-2,4-5H3/b10-9- |
| InChIKey | FIDSDUBEJRIFKS-KTKRTIGZSA-N |
| XLogP | 4.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-4-bromo-N-ethenyl-5,5-dimethylhept-3-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-bromo-N-ethenyl-5,5-dimethylhept-3-en-3-amine?
The IUPAC name of (Z)-4-bromo-N-ethenyl-5,5-dimethylhept-3-en-3-amine (CID 170130567) is (Z)-4-bromo-N-ethenyl-5,5-dimethylhept-3-en-3-amine.
What is the SMILES notation for (Z)-4-bromo-N-ethenyl-5,5-dimethylhept-3-en-3-amine?
The canonical SMILES for (Z)-4-bromo-N-ethenyl-5,5-dimethylhept-3-en-3-amine is C=CN/C(CC)=C(\Br)C(C)(C)CC.
What is the InChIKey of (Z)-4-bromo-N-ethenyl-5,5-dimethylhept-3-en-3-amine?
The InChIKey is FIDSDUBEJRIFKS-KTKRTIGZSA-N. The full InChI is InChI=1S/C11H20BrN/c1-6-9(13-8-3)10(12)11(4,5)7-2/h8,13H,3,6-7H2,1-2,4-5H3/b10-9-.
What are the key properties of (Z)-4-bromo-N-ethenyl-5,5-dimethylhept-3-en-3-amine?
(Z)-4-bromo-N-ethenyl-5,5-dimethylhept-3-en-3-amine has a molecular weight of 246.19 g/mol, XLogP of 4.17, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-bromo-N-ethenyl-5,5-dimethylhept-3-en-3-amine is sourced from PubChem (CID 170130567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).