C21H33NS — CID 170130957
8-(3-methylbutan-2-ylsulfanyl)-2-(2-methylpropyl)-3,4,6,6a,10a,10b-hexahydropyrido[2,1-a]isoindole (PubChem CID 170130957) has the molecular formula C21H33NS and a molecular weight of 331.57 g/mol. Its IUPAC name is 8-(3-methylbutan-2-ylsulfanyl)-2-(2-methylpropyl)-3,4,6,6a,10a,10b-hexahydropyrido[2,1-a]isoindole.
| Compound Name | 8-(3-methylbutan-2-ylsulfanyl)-2-(2-methylpropyl)-3,4,6,6a,10a,10b-hexahydropyrido[2,1-a]isoindole |
|---|---|
| PubChem CID | 170130957 |
| Molecular Formula | C21H33NS |
| Molecular Weight | 331.57 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 8-(3-methylbutan-2-ylsulfanyl)-2-(2-methylpropyl)-3,4,6,6a,10a,10b-hexahydropyrido[2,1-a]isoindole |
| SMILES | CC(C)CC1=CC2C3C=CC(SC(C)C(C)C)=CC3CN2CC1 |
| InChI | InChI=1S/C21H33NS/c1-14(2)10-17-8-9-22-13-18-12-19(23-16(5)15(3)4)6-7-20(18)21(22)11-17/h6-7,11-12,14-16,18,20-21H,8-10,13H2,1-5H3 |
| InChIKey | QPHGAONJZCZCRC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|