C18H32N2 — CID 170131384
(2Z,6Z)-N-[(3S)-3-ethyl-4-methylpent-4-enyl]-8-imino-5-methylnona-2,6-dien-2-amine (PubChem CID 170131384) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is (2Z,6Z)-N-[(3S)-3-ethyl-4-methylpent-4-enyl]-8-imino-5-methylnona-2,6-dien-2-amine.
| Compound Name | (2Z,6Z)-N-[(3S)-3-ethyl-4-methylpent-4-enyl]-8-imino-5-methylnona-2,6-dien-2-amine |
|---|---|
| PubChem CID | 170131384 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | (2Z,6Z)-N-[(3S)-3-ethyl-4-methylpent-4-enyl]-8-imino-5-methylnona-2,6-dien-2-amine |
| SMILES | [H]/N=C(C)/C=C\C(C)C/C=C(/C)NCCC(CC)C(=C)C |
| InChI | InChI=1S/C18H32N2/c1-7-18(14(2)3)12-13-20-17(6)11-9-15(4)8-10-16(5)19/h8,10-11,15,18-20H,2,7,9,12-13H2,1,3-6H3/b10-8-,17-11-,19-16+ |
| InChIKey | SNXVSOVNEINFOJ-XPYFQIHPSA-N |
| XLogP | 5.09 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|