C38H26N4S — CID 170131493
N-[amino(phenyl)methylidene]-3-(2-dibenzothiophen-4-ylcarbazol-9-yl)benzenecarboximidamide (PubChem CID 170131493) has the molecular formula C38H26N4S and a molecular weight of 570.72 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-3-(2-dibenzothiophen-4-ylcarbazol-9-yl)benzenecarboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-3-(2-dibenzothiophen-4-ylcarbazol-9-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 170131493 |
| Molecular Formula | C38H26N4S |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | N-[amino(phenyl)methylidene]-3-(2-dibenzothiophen-4-ylcarbazol-9-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N=C(/N)c1ccccc1)c1cccc(-n2c3ccccc3c3ccc(-c4cccc5c4sc4ccccc45)cc32)c1 |
| InChI | InChI=1S/C38H26N4S/c39-37(24-10-2-1-3-11-24)41-38(40)26-12-8-13-27(22-26)42-33-18-6-4-14-29(33)30-21-20-25(23-34(30)42)28-16-9-17-32-31-15-5-7-19-35(31)43-36(28)32/h1-23H,(H3,39,40,41) |
| InChIKey | VDXJUIGWBRBHJP-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|