About 3-[2,5-bis(2-phenylethynyl)-4-(2-sulfanylethoxymethyl)phenoxy]propane-1-sulfonic acid
3-[2,5-bis(2-phenylethynyl)-4-(2-sulfanylethoxymethyl)phenoxy]propane-1-sulfonic acid (PubChem CID 170133362) has the molecular formula C28H26O5S2
and a molecular weight of 506.65 g/mol. Its IUPAC name is 3-[2,5-bis(2-phenylethynyl)-4-(2-sulfanylethoxymethyl)phenoxy]propane-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-[2,5-bis(2-phenylethynyl)-4-(2-sulfanylethoxymethyl)phenoxy]propane-1-sulfonic acid |
| PubChem CID | 170133362 |
| Molecular Formula | C28H26O5S2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 3-[2,5-bis(2-phenylethynyl)-4-(2-sulfanylethoxymethyl)phenoxy]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCOc1cc(C#Cc2ccccc2)c(COCCS)cc1C#Cc1ccccc1 |
| InChI | InChI=1S/C28H26O5S2/c29-35(30,31)19-7-16-33-28-21-25(14-12-23-8-3-1-4-9-23)27(22-32-17-18-34)20-26(28)15-13-24-10-5-2-6-11-24/h1-6,8-11,20-21,34H,7,16-19,22H2,(H,29,30,31) |
| InChIKey | RKALFYVEXGJXBR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,5-bis(2-phenylethynyl)-4-(2-sulfanylethoxymethyl)phenoxy]propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,5-bis(2-phenylethynyl)-4-(2-sulfanylethoxymethyl)phenoxy]propane-1-sulfonic acid?
The IUPAC name of 3-[2,5-bis(2-phenylethynyl)-4-(2-sulfanylethoxymethyl)phenoxy]propane-1-sulfonic acid (CID 170133362) is 3-[2,5-bis(2-phenylethynyl)-4-(2-sulfanylethoxymethyl)phenoxy]propane-1-sulfonic acid.
What is the SMILES notation for 3-[2,5-bis(2-phenylethynyl)-4-(2-sulfanylethoxymethyl)phenoxy]propane-1-sulfonic acid?
The canonical SMILES for 3-[2,5-bis(2-phenylethynyl)-4-(2-sulfanylethoxymethyl)phenoxy]propane-1-sulfonic acid is O=S(=O)(O)CCCOc1cc(C#Cc2ccccc2)c(COCCS)cc1C#Cc1ccccc1.
What is the InChIKey of 3-[2,5-bis(2-phenylethynyl)-4-(2-sulfanylethoxymethyl)phenoxy]propane-1-sulfonic acid?
The InChIKey is RKALFYVEXGJXBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26O5S2/c29-35(30,31)19-7-16-33-28-21-25(14-12-23-8-3-1-4-9-23)27(22-32-17-18-34)20-26(28)15-13-24-10-5-2-6-11-24/h1-6,8-11,20-21,34H,7,16-19,22H2,(H,29,30,31).
What are the key properties of 3-[2,5-bis(2-phenylethynyl)-4-(2-sulfanylethoxymethyl)phenoxy]propane-1-sulfonic acid?
3-[2,5-bis(2-phenylethynyl)-4-(2-sulfanylethoxymethyl)phenoxy]propane-1-sulfonic acid has a molecular weight of 506.65 g/mol, XLogP of 4.59, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,5-bis(2-phenylethynyl)-4-(2-sulfanylethoxymethyl)phenoxy]propane-1-sulfonic acid is sourced from PubChem (CID 170133362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).