About 5-propan-2-yl-N,N-dipropyl-4-(trifluoromethyl)-1,3-thiazol-2-amine
5-propan-2-yl-N,N-dipropyl-4-(trifluoromethyl)-1,3-thiazol-2-amine (PubChem CID 170133924) has the molecular formula C13H21F3N2S
and a molecular weight of 294.39 g/mol. Its IUPAC name is 5-propan-2-yl-N,N-dipropyl-4-(trifluoromethyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-propan-2-yl-N,N-dipropyl-4-(trifluoromethyl)-1,3-thiazol-2-amine |
| PubChem CID | 170133924 |
| Molecular Formula | C13H21F3N2S |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 5-propan-2-yl-N,N-dipropyl-4-(trifluoromethyl)-1,3-thiazol-2-amine |
| SMILES | CCCN(CCC)c1nc(C(F)(F)F)c(C(C)C)s1 |
| InChI | InChI=1S/C13H21F3N2S/c1-5-7-18(8-6-2)12-17-11(13(14,15)16)10(19-12)9(3)4/h9H,5-8H2,1-4H3 |
| InChIKey | NYUHQLMOTWAVND-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-propan-2-yl-N,N-dipropyl-4-(trifluoromethyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-N,N-dipropyl-4-(trifluoromethyl)-1,3-thiazol-2-amine?
The IUPAC name of 5-propan-2-yl-N,N-dipropyl-4-(trifluoromethyl)-1,3-thiazol-2-amine (CID 170133924) is 5-propan-2-yl-N,N-dipropyl-4-(trifluoromethyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 5-propan-2-yl-N,N-dipropyl-4-(trifluoromethyl)-1,3-thiazol-2-amine?
The canonical SMILES for 5-propan-2-yl-N,N-dipropyl-4-(trifluoromethyl)-1,3-thiazol-2-amine is CCCN(CCC)c1nc(C(F)(F)F)c(C(C)C)s1.
What is the InChIKey of 5-propan-2-yl-N,N-dipropyl-4-(trifluoromethyl)-1,3-thiazol-2-amine?
The InChIKey is NYUHQLMOTWAVND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F3N2S/c1-5-7-18(8-6-2)12-17-11(13(14,15)16)10(19-12)9(3)4/h9H,5-8H2,1-4H3.
What are the key properties of 5-propan-2-yl-N,N-dipropyl-4-(trifluoromethyl)-1,3-thiazol-2-amine?
5-propan-2-yl-N,N-dipropyl-4-(trifluoromethyl)-1,3-thiazol-2-amine has a molecular weight of 294.39 g/mol, XLogP of 4.91, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-N,N-dipropyl-4-(trifluoromethyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 170133924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).