C15H22O5 — CID 170134905
(3aS,5R,5aR,9aR)-5-tert-butylperoxy-3a-hydroxy-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-2-one (PubChem CID 170134905) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (3aS,5R,5aR,9aR)-5-tert-butylperoxy-3a-hydroxy-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-2-one.
| Compound Name | (3aS,5R,5aR,9aR)-5-tert-butylperoxy-3a-hydroxy-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-2-one |
|---|---|
| PubChem CID | 170134905 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (3aS,5R,5aR,9aR)-5-tert-butylperoxy-3a-hydroxy-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-2-one |
| SMILES | CC(C)(C)OO[C@@H]1C[C@]2(O)CC(=O)O[C@@]23CC=CC[C@H]13 |
| InChI | InChI=1S/C15H22O5/c1-13(2,3)20-19-11-8-14(17)9-12(16)18-15(14)7-5-4-6-10(11)15/h4-5,10-11,17H,6-9H2,1-3H3/t10-,11-,14+,15-/m1/s1 |
| InChIKey | MPDDRAQYYAJGSC-HKCMKHECSA-N |
| XLogP | 1.89 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|