C19H26O5 — CID 170134968
[(1R,3S,5S,7R,8R,10S,12R)-5-acetyloxy-7-prop-2-enyl-2-oxatetracyclo[6.5.0.01,5.010,12]tridecan-3-yl] acetate (PubChem CID 170134968) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is [(1R,3S,5S,7R,8R,10S,12R)-5-acetyloxy-7-prop-2-enyl-2-oxatetracyclo[6.5.0.01,5.010,12]tridecan-3-yl] acetate.
| Compound Name | [(1R,3S,5S,7R,8R,10S,12R)-5-acetyloxy-7-prop-2-enyl-2-oxatetracyclo[6.5.0.01,5.010,12]tridecan-3-yl] acetate |
|---|---|
| PubChem CID | 170134968 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [(1R,3S,5S,7R,8R,10S,12R)-5-acetyloxy-7-prop-2-enyl-2-oxatetracyclo[6.5.0.01,5.010,12]tridecan-3-yl] acetate |
| SMILES | C=CC[C@@H]1C[C@]2(OC(C)=O)C[C@H](OC(C)=O)O[C@@]23C[C@H]2C[C@H]2C[C@H]13 |
| InChI | InChI=1S/C19H26O5/c1-4-5-13-8-18(23-12(3)21)10-17(22-11(2)20)24-19(18)9-15-6-14(15)7-16(13)19/h4,13-17H,1,5-10H2,2-3H3/t13-,14+,15-,16-,17-,18+,19-/m1/s1 |
| InChIKey | UWNGFGRKZPQQAD-PPXQIISCSA-N |
| XLogP | 2.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|