C58H42N8 — CID 170137245
N-[[[2-(2-aminophenyl)-9-[4-(4-naphthalen-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazol-1-yl]-methylamino]-phenylmethylidene]benzenecarboximidamide (PubChem CID 170137245) has the molecular formula C58H42N8 and a molecular weight of 851.03 g/mol. Its IUPAC name is N-[[[2-(2-aminophenyl)-9-[4-(4-naphthalen-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazol-1-yl]-methylamino]-phenylmethylidene]benzenecarboximidamide.
| Compound Name | N-[[[2-(2-aminophenyl)-9-[4-(4-naphthalen-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazol-1-yl]-methylamino]-phenylmethylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 170137245 |
| Molecular Formula | C58H42N8 |
| Molecular Weight | 851.03 g/mol |
| Exact Mass | 850.35 |
| IUPAC Name | N-[[[2-(2-aminophenyl)-9-[4-(4-naphthalen-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazol-1-yl]-methylamino]-phenylmethylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(\c1ccccc1)N(C)c1c(-c2ccccc2N)ccc2c3ccccc3n(-c3ccc(-c4nc(-c5ccccc5)nc(-c5cccc6ccccc56)n4)cc3)c12)c1ccccc1 |
| InChI | InChI=1S/C58H42N8/c1-65(58(42-23-9-4-10-24-42)61-54(60)39-19-5-2-6-20-39)52-47(45-27-13-15-30-50(45)59)36-37-48-46-28-14-16-31-51(46)66(53(48)52)43-34-32-41(33-35-43)56-62-55(40-21-7-3-8-22-40)63-57(64-56)49-29-17-25-38-18-11-12-26-44(38)49/h2-37,60H,59H2,1H3/b60-54+,61-58+ |
| InChIKey | NHSPVVPIZUOTEJ-DXPJEDAASA-N |
| XLogP | 13.28 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.03 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|