C17H26N2S — CID 170140043
5-ethenyl-4-[(3Z)-5-methyl-5-propylocta-1,3-dien-4-yl]-1,3-thiazol-2-amine (PubChem CID 170140043) has the molecular formula C17H26N2S and a molecular weight of 290.48 g/mol. Its IUPAC name is 5-ethenyl-4-[(3Z)-5-methyl-5-propylocta-1,3-dien-4-yl]-1,3-thiazol-2-amine.
| Compound Name | 5-ethenyl-4-[(3Z)-5-methyl-5-propylocta-1,3-dien-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 170140043 |
| Molecular Formula | C17H26N2S |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 5-ethenyl-4-[(3Z)-5-methyl-5-propylocta-1,3-dien-4-yl]-1,3-thiazol-2-amine |
| SMILES | C=C/C=C(\c1nc(N)sc1C=C)C(C)(CCC)CCC |
| InChI | InChI=1S/C17H26N2S/c1-6-10-13(17(5,11-7-2)12-8-3)15-14(9-4)20-16(18)19-15/h6,9-10H,1,4,7-8,11-12H2,2-3,5H3,(H2,18,19)/b13-10+ |
| InChIKey | IROMOZSLTQKHET-JLHYYAGUSA-N |
| XLogP | 5.54 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|