About (8R)-8-methyl-9-(2-methylphenyl)-7-phenyl-7,8-dihydropurin-7-ium iodide
(8R)-8-methyl-9-(2-methylphenyl)-7-phenyl-7,8-dihydropurin-7-ium iodide (PubChem CID 170140774) has the molecular formula C19H19IN4
and a molecular weight of 430.29 g/mol. Its IUPAC name is (8R)-8-methyl-9-(2-methylphenyl)-7-phenyl-7,8-dihydropurin-7-ium iodide.
Molecular Properties
| Compound Name | (8R)-8-methyl-9-(2-methylphenyl)-7-phenyl-7,8-dihydropurin-7-ium iodide |
| PubChem CID | 170140774 |
| Molecular Formula | C19H19IN4 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | (8R)-8-methyl-9-(2-methylphenyl)-7-phenyl-7,8-dihydropurin-7-ium iodide |
| SMILES | Cc1ccccc1N1c2ncncc2[NH+](c2ccccc2)[C@@H]1C.[I-] |
| InChI | InChI=1S/C19H18N4.HI/c1-14-8-6-7-11-17(14)23-15(2)22(16-9-4-3-5-10-16)18-12-20-13-21-19(18)23;/h3-13,15H,1-2H3;1H/t15-;/m0./s1 |
| InChIKey | QEEFVHFHSZSALC-RSAXXLAASA-N |
| XLogP | 0.13 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (8R)-8-methyl-9-(2-methylphenyl)-7-phenyl-7,8-dihydropurin-7-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R)-8-methyl-9-(2-methylphenyl)-7-phenyl-7,8-dihydropurin-7-ium iodide?
The IUPAC name of (8R)-8-methyl-9-(2-methylphenyl)-7-phenyl-7,8-dihydropurin-7-ium iodide (CID 170140774) is (8R)-8-methyl-9-(2-methylphenyl)-7-phenyl-7,8-dihydropurin-7-ium iodide.
What is the SMILES notation for (8R)-8-methyl-9-(2-methylphenyl)-7-phenyl-7,8-dihydropurin-7-ium iodide?
The canonical SMILES for (8R)-8-methyl-9-(2-methylphenyl)-7-phenyl-7,8-dihydropurin-7-ium iodide is Cc1ccccc1N1c2ncncc2[NH+](c2ccccc2)[C@@H]1C.[I-].
What is the InChIKey of (8R)-8-methyl-9-(2-methylphenyl)-7-phenyl-7,8-dihydropurin-7-ium iodide?
The InChIKey is QEEFVHFHSZSALC-RSAXXLAASA-N. The full InChI is InChI=1S/C19H18N4.HI/c1-14-8-6-7-11-17(14)23-15(2)22(16-9-4-3-5-10-16)18-12-20-13-21-19(18)23;/h3-13,15H,1-2H3;1H/t15-;/m0./s1.
What are the key properties of (8R)-8-methyl-9-(2-methylphenyl)-7-phenyl-7,8-dihydropurin-7-ium iodide?
(8R)-8-methyl-9-(2-methylphenyl)-7-phenyl-7,8-dihydropurin-7-ium iodide has a molecular weight of 430.29 g/mol, XLogP of 0.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8R)-8-methyl-9-(2-methylphenyl)-7-phenyl-7,8-dihydropurin-7-ium iodide is sourced from PubChem (CID 170140774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).