C20H26N2O3S — CID 17014094
2-(2-methoxyphenoxy)-N-(2-piperidin-1-yl-2-thiophen-2-ylethyl)acetamide (PubChem CID 17014094) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-(2-piperidin-1-yl-2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(2-methoxyphenoxy)-N-(2-piperidin-1-yl-2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 17014094 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-(2-piperidin-1-yl-2-thiophen-2-ylethyl)acetamide |
| SMILES | COc1ccccc1OCC(=O)NCC(c1cccs1)N1CCCCC1 |
| InChI | InChI=1S/C20H26N2O3S/c1-24-17-8-3-4-9-18(17)25-15-20(23)21-14-16(19-10-7-13-26-19)22-11-5-2-6-12-22/h3-4,7-10,13,16H,2,5-6,11-12,14-15H2,1H3,(H,21,23) |
| InChIKey | KFXZPCVOQJLDIG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |