C25H29N — CID 170140945
4-(3,5-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine (PubChem CID 170140945) has the molecular formula C25H29N and a molecular weight of 343.51 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine.
| Compound Name | 4-(3,5-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine |
|---|---|
| PubChem CID | 170140945 |
| Molecular Formula | C25H29N |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine |
| SMILES | CCC=CC(C)C1CC=CC=C1c1cc(-c2cc(C)cc(C)c2)ccn1 |
| InChI | InChI=1S/C25H29N/c1-5-6-9-20(4)23-10-7-8-11-24(23)25-17-21(12-13-26-25)22-15-18(2)14-19(3)16-22/h6-9,11-17,20,23H,5,10H2,1-4H3 |
| InChIKey | FJLMLKQJFOIBOS-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|