About 5-(4,4-dimethylpentyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene
5-(4,4-dimethylpentyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene (PubChem CID 170141085) has the molecular formula C21H35I
and a molecular weight of 414.42 g/mol. Its IUPAC name is 5-(4,4-dimethylpentyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 5-(4,4-dimethylpentyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene |
| PubChem CID | 170141085 |
| Molecular Formula | C21H35I |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 5-(4,4-dimethylpentyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene |
| SMILES | Cc1cc(CCCC(C)(C)C)cc(C)c1CCCC(C)(C)I |
| InChI | InChI=1S/C21H35I/c1-16-14-18(10-8-12-20(3,4)5)15-17(2)19(16)11-9-13-21(6,7)22/h14-15H,8-13H2,1-7H3 |
| InChIKey | NDJLCMWGXZMBJO-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(4,4-dimethylpentyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,4-dimethylpentyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene?
The IUPAC name of 5-(4,4-dimethylpentyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene (CID 170141085) is 5-(4,4-dimethylpentyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene.
What is the SMILES notation for 5-(4,4-dimethylpentyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene?
The canonical SMILES for 5-(4,4-dimethylpentyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene is Cc1cc(CCCC(C)(C)C)cc(C)c1CCCC(C)(C)I.
What is the InChIKey of 5-(4,4-dimethylpentyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene?
The InChIKey is NDJLCMWGXZMBJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H35I/c1-16-14-18(10-8-12-20(3,4)5)15-17(2)19(16)11-9-13-21(6,7)22/h14-15H,8-13H2,1-7H3.
What are the key properties of 5-(4,4-dimethylpentyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene?
5-(4,4-dimethylpentyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene has a molecular weight of 414.42 g/mol, XLogP of 7.21, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,4-dimethylpentyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene is sourced from PubChem (CID 170141085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).