C23H28N4O3 — CID 170141715
N-[C-ethenyl-N-(6-methoxy-2-methyl-3-pyridin-4-ylphenyl)carbonimidoyl]-4-hydroxy-4-methylpiperidine-1-carboxamide (PubChem CID 170141715) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[C-ethenyl-N-(6-methoxy-2-methyl-3-pyridin-4-ylphenyl)carbonimidoyl]-4-hydroxy-4-methylpiperidine-1-carboxamide.
| Compound Name | N-[C-ethenyl-N-(6-methoxy-2-methyl-3-pyridin-4-ylphenyl)carbonimidoyl]-4-hydroxy-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 170141715 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[C-ethenyl-N-(6-methoxy-2-methyl-3-pyridin-4-ylphenyl)carbonimidoyl]-4-hydroxy-4-methylpiperidine-1-carboxamide |
| SMILES | C=C/C(=N\c1c(OC)ccc(-c2ccncc2)c1C)NC(=O)N1CCC(C)(O)CC1 |
| InChI | InChI=1S/C23H28N4O3/c1-5-20(26-22(28)27-14-10-23(3,29)11-15-27)25-21-16(2)18(6-7-19(21)30-4)17-8-12-24-13-9-17/h5-9,12-13,29H,1,10-11,14-15H2,2-4H3,(H,25,26,28) |
| InChIKey | GPFDZLMIBJTHEN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|