C33H43N3O5S — CID 170142311
3-tert-butyl-1-[2-(2-methoxyphenyl)-2-[(1S)-2,2,3,3,4-pentamethylcyclopentyl]oxyethyl]-5-methyl-6-(1,3-oxazol-2-yl)thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 170142311) has the molecular formula C33H43N3O5S and a molecular weight of 593.79 g/mol. Its IUPAC name is 3-tert-butyl-1-[2-(2-methoxyphenyl)-2-[(1S)-2,2,3,3,4-pentamethylcyclopentyl]oxyethyl]-5-methyl-6-(1,3-oxazol-2-yl)thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-tert-butyl-1-[2-(2-methoxyphenyl)-2-[(1S)-2,2,3,3,4-pentamethylcyclopentyl]oxyethyl]-5-methyl-6-(1,3-oxazol-2-yl)thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170142311 |
| Molecular Formula | C33H43N3O5S |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | 3-tert-butyl-1-[2-(2-methoxyphenyl)-2-[(1S)-2,2,3,3,4-pentamethylcyclopentyl]oxyethyl]-5-methyl-6-(1,3-oxazol-2-yl)thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | COc1ccccc1C(Cn1c(=O)n(C(C)(C)C)c(=O)c2c(C)c(-c3ncco3)sc21)O[C@H]1CC(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C33H43N3O5S/c1-19-17-24(33(8,9)32(19,6)7)41-23(21-13-11-12-14-22(21)39-10)18-35-29-25(28(37)36(30(35)38)31(3,4)5)20(2)26(42-29)27-34-15-16-40-27/h11-16,19,23-24H,17-18H2,1-10H3/t19?,23?,24-/m0/s1 |
| InChIKey | VYOMNNAHMPYQQV-TVNWEXPRSA-N |
| XLogP | 7.17 |
| TPSA | 88.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |