About 1-ethyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine
1-ethyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine (PubChem CID 170142949) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 1-ethyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine.
Molecular Properties
| Compound Name | 1-ethyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine |
| PubChem CID | 170142949 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 1-ethyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine |
| SMILES | C=C/C=C(/C)N(N)CC |
| InChI | InChI=1S/C7H14N2/c1-4-6-7(3)9(8)5-2/h4,6H,1,5,8H2,2-3H3/b7-6- |
| InChIKey | HWTUDLKCGWKDRV-SREVYHEPSA-N |
| XLogP | 1.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine?
The IUPAC name of 1-ethyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine (CID 170142949) is 1-ethyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine.
What is the SMILES notation for 1-ethyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine?
The canonical SMILES for 1-ethyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine is C=C/C=C(/C)N(N)CC.
What is the InChIKey of 1-ethyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine?
The InChIKey is HWTUDLKCGWKDRV-SREVYHEPSA-N. The full InChI is InChI=1S/C7H14N2/c1-4-6-7(3)9(8)5-2/h4,6H,1,5,8H2,2-3H3/b7-6-.
What are the key properties of 1-ethyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine?
1-ethyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine has a molecular weight of 126.20 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine is sourced from PubChem (CID 170142949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).