C15H23N — CID 170143241
(3Z)-6-methyl-N-[(1E,3Z)-5-methylhexa-1,3,5-trienyl]hepta-1,3-dien-2-amine (PubChem CID 170143241) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (3Z)-6-methyl-N-[(1E,3Z)-5-methylhexa-1,3,5-trienyl]hepta-1,3-dien-2-amine.
| Compound Name | (3Z)-6-methyl-N-[(1E,3Z)-5-methylhexa-1,3,5-trienyl]hepta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 170143241 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (3Z)-6-methyl-N-[(1E,3Z)-5-methylhexa-1,3,5-trienyl]hepta-1,3-dien-2-amine |
| SMILES | C=C(C)/C=C\C=C\NC(=C)/C=C\CC(C)C |
| InChI | InChI=1S/C15H23N/c1-13(2)9-6-7-12-16-15(5)11-8-10-14(3)4/h6-9,11-12,14,16H,1,5,10H2,2-4H3/b9-6-,11-8-,12-7+ |
| InChIKey | DLAUKPHYKBLJOQ-UPMKPVFUSA-N |
| XLogP | 4.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|