About 2-(3,5-difluoro-4-hydroxyphenyl)propan-2-yl 2,2-dimethylpropanoate
2-(3,5-difluoro-4-hydroxyphenyl)propan-2-yl 2,2-dimethylpropanoate (PubChem CID 170143455) has the molecular formula C14H18F2O3
and a molecular weight of 272.29 g/mol. Its IUPAC name is 2-(3,5-difluoro-4-hydroxyphenyl)propan-2-yl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | 2-(3,5-difluoro-4-hydroxyphenyl)propan-2-yl 2,2-dimethylpropanoate |
| PubChem CID | 170143455 |
| Molecular Formula | C14H18F2O3 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-(3,5-difluoro-4-hydroxyphenyl)propan-2-yl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(C)(C)c1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C14H18F2O3/c1-13(2,3)12(18)19-14(4,5)8-6-9(15)11(17)10(16)7-8/h6-7,17H,1-5H3 |
| InChIKey | CLNVSWUABFSOBQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,5-difluoro-4-hydroxyphenyl)propan-2-yl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluoro-4-hydroxyphenyl)propan-2-yl 2,2-dimethylpropanoate?
The IUPAC name of 2-(3,5-difluoro-4-hydroxyphenyl)propan-2-yl 2,2-dimethylpropanoate (CID 170143455) is 2-(3,5-difluoro-4-hydroxyphenyl)propan-2-yl 2,2-dimethylpropanoate.
What is the SMILES notation for 2-(3,5-difluoro-4-hydroxyphenyl)propan-2-yl 2,2-dimethylpropanoate?
The canonical SMILES for 2-(3,5-difluoro-4-hydroxyphenyl)propan-2-yl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OC(C)(C)c1cc(F)c(O)c(F)c1.
What is the InChIKey of 2-(3,5-difluoro-4-hydroxyphenyl)propan-2-yl 2,2-dimethylpropanoate?
The InChIKey is CLNVSWUABFSOBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F2O3/c1-13(2,3)12(18)19-14(4,5)8-6-9(15)11(17)10(16)7-8/h6-7,17H,1-5H3.
What are the key properties of 2-(3,5-difluoro-4-hydroxyphenyl)propan-2-yl 2,2-dimethylpropanoate?
2-(3,5-difluoro-4-hydroxyphenyl)propan-2-yl 2,2-dimethylpropanoate has a molecular weight of 272.29 g/mol, XLogP of 3.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluoro-4-hydroxyphenyl)propan-2-yl 2,2-dimethylpropanoate is sourced from PubChem (CID 170143455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).