About 7-(aminomethyl)-5-methoxy-2-methylsulfanylbicyclo[4.2.0]octa-1(6),2,4-triene-3-thiol
7-(aminomethyl)-5-methoxy-2-methylsulfanylbicyclo[4.2.0]octa-1(6),2,4-triene-3-thiol (PubChem CID 170143731) has the molecular formula C11H15NOS2
and a molecular weight of 241.38 g/mol. Its IUPAC name is 7-(aminomethyl)-5-methoxy-2-methylsulfanylbicyclo[4.2.0]octa-1(6),2,4-triene-3-thiol.
Molecular Properties
| Compound Name | 7-(aminomethyl)-5-methoxy-2-methylsulfanylbicyclo[4.2.0]octa-1(6),2,4-triene-3-thiol |
| PubChem CID | 170143731 |
| Molecular Formula | C11H15NOS2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 7-(aminomethyl)-5-methoxy-2-methylsulfanylbicyclo[4.2.0]octa-1(6),2,4-triene-3-thiol |
| SMILES | COc1cc(S)c(SC)c2c1C(CN)C2 |
| InChI | InChI=1S/C11H15NOS2/c1-13-8-4-9(14)11(15-2)7-3-6(5-12)10(7)8/h4,6,14H,3,5,12H2,1-2H3 |
| InChIKey | SBYPMDIKGHEASE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 7-(aminomethyl)-5-methoxy-2-methylsulfanylbicyclo[4.2.0]octa-1(6),2,4-triene-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(aminomethyl)-5-methoxy-2-methylsulfanylbicyclo[4.2.0]octa-1(6),2,4-triene-3-thiol?
The IUPAC name of 7-(aminomethyl)-5-methoxy-2-methylsulfanylbicyclo[4.2.0]octa-1(6),2,4-triene-3-thiol (CID 170143731) is 7-(aminomethyl)-5-methoxy-2-methylsulfanylbicyclo[4.2.0]octa-1(6),2,4-triene-3-thiol.
What is the SMILES notation for 7-(aminomethyl)-5-methoxy-2-methylsulfanylbicyclo[4.2.0]octa-1(6),2,4-triene-3-thiol?
The canonical SMILES for 7-(aminomethyl)-5-methoxy-2-methylsulfanylbicyclo[4.2.0]octa-1(6),2,4-triene-3-thiol is COc1cc(S)c(SC)c2c1C(CN)C2.
What is the InChIKey of 7-(aminomethyl)-5-methoxy-2-methylsulfanylbicyclo[4.2.0]octa-1(6),2,4-triene-3-thiol?
The InChIKey is SBYPMDIKGHEASE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NOS2/c1-13-8-4-9(14)11(15-2)7-3-6(5-12)10(7)8/h4,6,14H,3,5,12H2,1-2H3.
What are the key properties of 7-(aminomethyl)-5-methoxy-2-methylsulfanylbicyclo[4.2.0]octa-1(6),2,4-triene-3-thiol?
7-(aminomethyl)-5-methoxy-2-methylsulfanylbicyclo[4.2.0]octa-1(6),2,4-triene-3-thiol has a molecular weight of 241.38 g/mol, XLogP of 2.30, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(aminomethyl)-5-methoxy-2-methylsulfanylbicyclo[4.2.0]octa-1(6),2,4-triene-3-thiol is sourced from PubChem (CID 170143731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).