About (4R)-3,3-dimethyl-4-(2-methylidenepentylamino)hex-1-en-2-ol
(4R)-3,3-dimethyl-4-(2-methylidenepentylamino)hex-1-en-2-ol (PubChem CID 170144299) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is (4R)-3,3-dimethyl-4-(2-methylidenepentylamino)hex-1-en-2-ol.
Molecular Properties
| Compound Name | (4R)-3,3-dimethyl-4-(2-methylidenepentylamino)hex-1-en-2-ol |
| PubChem CID | 170144299 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | (4R)-3,3-dimethyl-4-(2-methylidenepentylamino)hex-1-en-2-ol |
| SMILES | C=C(CCC)CN[C@H](CC)C(C)(C)C(=C)O |
| InChI | InChI=1S/C14H27NO/c1-7-9-11(3)10-15-13(8-2)14(5,6)12(4)16/h13,15-16H,3-4,7-10H2,1-2,5-6H3/t13-/m1/s1 |
| InChIKey | WDWCQPNLTFTMOT-CYBMUJFWSA-N |
| XLogP | 3.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-3,3-dimethyl-4-(2-methylidenepentylamino)hex-1-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3,3-dimethyl-4-(2-methylidenepentylamino)hex-1-en-2-ol?
The IUPAC name of (4R)-3,3-dimethyl-4-(2-methylidenepentylamino)hex-1-en-2-ol (CID 170144299) is (4R)-3,3-dimethyl-4-(2-methylidenepentylamino)hex-1-en-2-ol.
What is the SMILES notation for (4R)-3,3-dimethyl-4-(2-methylidenepentylamino)hex-1-en-2-ol?
The canonical SMILES for (4R)-3,3-dimethyl-4-(2-methylidenepentylamino)hex-1-en-2-ol is C=C(CCC)CN[C@H](CC)C(C)(C)C(=C)O.
What is the InChIKey of (4R)-3,3-dimethyl-4-(2-methylidenepentylamino)hex-1-en-2-ol?
The InChIKey is WDWCQPNLTFTMOT-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H27NO/c1-7-9-11(3)10-15-13(8-2)14(5,6)12(4)16/h13,15-16H,3-4,7-10H2,1-2,5-6H3/t13-/m1/s1.
What are the key properties of (4R)-3,3-dimethyl-4-(2-methylidenepentylamino)hex-1-en-2-ol?
(4R)-3,3-dimethyl-4-(2-methylidenepentylamino)hex-1-en-2-ol has a molecular weight of 225.38 g/mol, XLogP of 3.81, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3,3-dimethyl-4-(2-methylidenepentylamino)hex-1-en-2-ol is sourced from PubChem (CID 170144299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).