C9H17FN2 — CID 170144467
1-[(3Z)-4-fluorohexa-3,5-dien-3-yl]-1,2,2-trimethylhydrazine (PubChem CID 170144467) has the molecular formula C9H17FN2 and a molecular weight of 172.25 g/mol. Its IUPAC name is 1-[(3Z)-4-fluorohexa-3,5-dien-3-yl]-1,2,2-trimethylhydrazine.
| Compound Name | 1-[(3Z)-4-fluorohexa-3,5-dien-3-yl]-1,2,2-trimethylhydrazine |
|---|---|
| PubChem CID | 170144467 |
| Molecular Formula | C9H17FN2 |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | 1-[(3Z)-4-fluorohexa-3,5-dien-3-yl]-1,2,2-trimethylhydrazine |
| SMILES | C=C/C(F)=C(\CC)N(C)N(C)C |
| InChI | InChI=1S/C9H17FN2/c1-6-8(10)9(7-2)12(5)11(3)4/h6H,1,7H2,2-5H3/b9-8- |
| InChIKey | NXYARWCBSGIEFJ-HJWRWDBZSA-N |
| XLogP | 2.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|