C24H27Cl2FN4 — CID 170144486
1-N-(3,5-dichloro-2-fluorophenyl)-7-N-(4-piperidin-1-ylbutyl)isoquinoline-1,7-diamine (PubChem CID 170144486) has the molecular formula C24H27Cl2FN4 and a molecular weight of 461.41 g/mol. Its IUPAC name is 1-N-(3,5-dichloro-2-fluorophenyl)-7-N-(4-piperidin-1-ylbutyl)isoquinoline-1,7-diamine.
| Compound Name | 1-N-(3,5-dichloro-2-fluorophenyl)-7-N-(4-piperidin-1-ylbutyl)isoquinoline-1,7-diamine |
|---|---|
| PubChem CID | 170144486 |
| Molecular Formula | C24H27Cl2FN4 |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 1-N-(3,5-dichloro-2-fluorophenyl)-7-N-(4-piperidin-1-ylbutyl)isoquinoline-1,7-diamine |
| SMILES | Fc1c(Cl)cc(Cl)cc1Nc1nccc2ccc(NCCCCN3CCCCC3)cc12 |
| InChI | InChI=1S/C24H27Cl2FN4/c25-18-14-21(26)23(27)22(15-18)30-24-20-16-19(7-6-17(20)8-10-29-24)28-9-2-5-13-31-11-3-1-4-12-31/h6-8,10,14-16,28H,1-5,9,11-13H2,(H,29,30) |
| InChIKey | UNBPYPMOJHEBOF-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|