About 4-tert-butyl-1,2-dimethyl-2,3-dihydropyridin-1-ium
4-tert-butyl-1,2-dimethyl-2,3-dihydropyridin-1-ium (PubChem CID 170144837) has the molecular formula C11H20N+
and a molecular weight of 166.29 g/mol. Its IUPAC name is 4-tert-butyl-1,2-dimethyl-2,3-dihydropyridin-1-ium.
Molecular Properties
| Compound Name | 4-tert-butyl-1,2-dimethyl-2,3-dihydropyridin-1-ium |
| PubChem CID | 170144837 |
| Molecular Formula | C11H20N+ |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.16 |
| IUPAC Name | 4-tert-butyl-1,2-dimethyl-2,3-dihydropyridin-1-ium |
| SMILES | CC1CC(C(C)(C)C)=CC=[N+]1C |
| InChI | InChI=1S/C11H20N/c1-9-8-10(11(2,3)4)6-7-12(9)5/h6-7,9H,8H2,1-5H3/q+1 |
| InChIKey | NXZZLTNKIOWNFK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-1,2-dimethyl-2,3-dihydropyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1,2-dimethyl-2,3-dihydropyridin-1-ium?
The IUPAC name of 4-tert-butyl-1,2-dimethyl-2,3-dihydropyridin-1-ium (CID 170144837) is 4-tert-butyl-1,2-dimethyl-2,3-dihydropyridin-1-ium.
What is the SMILES notation for 4-tert-butyl-1,2-dimethyl-2,3-dihydropyridin-1-ium?
The canonical SMILES for 4-tert-butyl-1,2-dimethyl-2,3-dihydropyridin-1-ium is CC1CC(C(C)(C)C)=CC=[N+]1C.
What is the InChIKey of 4-tert-butyl-1,2-dimethyl-2,3-dihydropyridin-1-ium?
The InChIKey is NXZZLTNKIOWNFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N/c1-9-8-10(11(2,3)4)6-7-12(9)5/h6-7,9H,8H2,1-5H3/q+1.
What are the key properties of 4-tert-butyl-1,2-dimethyl-2,3-dihydropyridin-1-ium?
4-tert-butyl-1,2-dimethyl-2,3-dihydropyridin-1-ium has a molecular weight of 166.29 g/mol, XLogP of 2.46, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1,2-dimethyl-2,3-dihydropyridin-1-ium is sourced from PubChem (CID 170144837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).