C19H25F2N — CID 170147186
5-(5-tert-butyl-3-ethenylcyclohexa-1,5-dien-1-yl)-3-(1,1-difluoroethyl)-2,3-dihydropyridine (PubChem CID 170147186) has the molecular formula C19H25F2N and a molecular weight of 305.41 g/mol. Its IUPAC name is 5-(5-tert-butyl-3-ethenylcyclohexa-1,5-dien-1-yl)-3-(1,1-difluoroethyl)-2,3-dihydropyridine.
| Compound Name | 5-(5-tert-butyl-3-ethenylcyclohexa-1,5-dien-1-yl)-3-(1,1-difluoroethyl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 170147186 |
| Molecular Formula | C19H25F2N |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 5-(5-tert-butyl-3-ethenylcyclohexa-1,5-dien-1-yl)-3-(1,1-difluoroethyl)-2,3-dihydropyridine |
| SMILES | C=CC1C=C(C2=CC(C(C)(F)F)CN=C2)C=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C19H25F2N/c1-6-13-7-14(9-16(8-13)18(2,3)4)15-10-17(12-22-11-15)19(5,20)21/h6-7,9-11,13,17H,1,8,12H2,2-5H3 |
| InChIKey | FYKBPBOJSDKKTM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|