C15H14F3NO2S — CID 170147214
methyl 2-[2-sulfanyl-4-[(3Z)-6,6,6-trifluorohexa-1,3-dien-2-yl]phenyl]iminoacetate (PubChem CID 170147214) has the molecular formula C15H14F3NO2S and a molecular weight of 329.34 g/mol. Its IUPAC name is methyl 2-[2-sulfanyl-4-[(3Z)-6,6,6-trifluorohexa-1,3-dien-2-yl]phenyl]iminoacetate.
| Compound Name | methyl 2-[2-sulfanyl-4-[(3Z)-6,6,6-trifluorohexa-1,3-dien-2-yl]phenyl]iminoacetate |
|---|---|
| PubChem CID | 170147214 |
| Molecular Formula | C15H14F3NO2S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | methyl 2-[2-sulfanyl-4-[(3Z)-6,6,6-trifluorohexa-1,3-dien-2-yl]phenyl]iminoacetate |
| SMILES | C=C(/C=C\CC(F)(F)F)c1ccc(/N=C/C(=O)OC)c(S)c1 |
| InChI | InChI=1S/C15H14F3NO2S/c1-10(4-3-7-15(16,17)18)11-5-6-12(13(22)8-11)19-9-14(20)21-2/h3-6,8-9,22H,1,7H2,2H3/b4-3-,19-9+ |
| InChIKey | SSEGWOHSFAGIGA-IJYIPRFUSA-N |
| XLogP | 4.37 |
| TPSA | 38.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|