About 5-[3-[(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)oxymethyl]phenyl]-2H-triazole-4-carbonitrile
5-[3-[(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)oxymethyl]phenyl]-2H-triazole-4-carbonitrile (PubChem CID 170147881) has the molecular formula C19H15N5O2
and a molecular weight of 345.36 g/mol. Its IUPAC name is 5-[3-[(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)oxymethyl]phenyl]-2H-triazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-[3-[(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)oxymethyl]phenyl]-2H-triazole-4-carbonitrile |
| PubChem CID | 170147881 |
| Molecular Formula | C19H15N5O2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 5-[3-[(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)oxymethyl]phenyl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1cccc(COc2ccc3c(c2)C(=O)NCC3)c1 |
| InChI | InChI=1S/C19H15N5O2/c20-10-17-18(23-24-22-17)14-3-1-2-12(8-14)11-26-15-5-4-13-6-7-21-19(25)16(13)9-15/h1-5,8-9H,6-7,11H2,(H,21,25)(H,22,23,24) |
| InChIKey | IACOMZSMUFENAT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[3-[(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)oxymethyl]phenyl]-2H-triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)oxymethyl]phenyl]-2H-triazole-4-carbonitrile?
The IUPAC name of 5-[3-[(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)oxymethyl]phenyl]-2H-triazole-4-carbonitrile (CID 170147881) is 5-[3-[(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)oxymethyl]phenyl]-2H-triazole-4-carbonitrile.
What is the SMILES notation for 5-[3-[(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)oxymethyl]phenyl]-2H-triazole-4-carbonitrile?
The canonical SMILES for 5-[3-[(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)oxymethyl]phenyl]-2H-triazole-4-carbonitrile is N#Cc1n[nH]nc1-c1cccc(COc2ccc3c(c2)C(=O)NCC3)c1.
What is the InChIKey of 5-[3-[(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)oxymethyl]phenyl]-2H-triazole-4-carbonitrile?
The InChIKey is IACOMZSMUFENAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N5O2/c20-10-17-18(23-24-22-17)14-3-1-2-12(8-14)11-26-15-5-4-13-6-7-21-19(25)16(13)9-15/h1-5,8-9H,6-7,11H2,(H,21,25)(H,22,23,24).
What are the key properties of 5-[3-[(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)oxymethyl]phenyl]-2H-triazole-4-carbonitrile?
5-[3-[(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)oxymethyl]phenyl]-2H-triazole-4-carbonitrile has a molecular weight of 345.36 g/mol, XLogP of 2.21, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)oxymethyl]phenyl]-2H-triazole-4-carbonitrile is sourced from PubChem (CID 170147881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).