About 5-[5-(4-octylcyclohexa-2,4-dien-1-yl)thiophen-2-yl]-2H-triazol-4-amine
5-[5-(4-octylcyclohexa-2,4-dien-1-yl)thiophen-2-yl]-2H-triazol-4-amine (PubChem CID 170148087) has the molecular formula C20H28N4S
and a molecular weight of 356.54 g/mol. Its IUPAC name is 5-[5-(4-octylcyclohexa-2,4-dien-1-yl)thiophen-2-yl]-2H-triazol-4-amine.
Molecular Properties
| Compound Name | 5-[5-(4-octylcyclohexa-2,4-dien-1-yl)thiophen-2-yl]-2H-triazol-4-amine |
| PubChem CID | 170148087 |
| Molecular Formula | C20H28N4S |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 5-[5-(4-octylcyclohexa-2,4-dien-1-yl)thiophen-2-yl]-2H-triazol-4-amine |
| SMILES | CCCCCCCCC1=CCC(c2ccc(-c3n[nH]nc3N)s2)C=C1 |
| InChI | InChI=1S/C20H28N4S/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)17-13-14-18(25-17)19-20(21)23-24-22-19/h9-11,13-14,16H,2-8,12H2,1H3,(H3,21,22,23,24) |
| InChIKey | KVCBVQGJHVKXJW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-(4-octylcyclohexa-2,4-dien-1-yl)thiophen-2-yl]-2H-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(4-octylcyclohexa-2,4-dien-1-yl)thiophen-2-yl]-2H-triazol-4-amine?
The IUPAC name of 5-[5-(4-octylcyclohexa-2,4-dien-1-yl)thiophen-2-yl]-2H-triazol-4-amine (CID 170148087) is 5-[5-(4-octylcyclohexa-2,4-dien-1-yl)thiophen-2-yl]-2H-triazol-4-amine.
What is the SMILES notation for 5-[5-(4-octylcyclohexa-2,4-dien-1-yl)thiophen-2-yl]-2H-triazol-4-amine?
The canonical SMILES for 5-[5-(4-octylcyclohexa-2,4-dien-1-yl)thiophen-2-yl]-2H-triazol-4-amine is CCCCCCCCC1=CCC(c2ccc(-c3n[nH]nc3N)s2)C=C1.
What is the InChIKey of 5-[5-(4-octylcyclohexa-2,4-dien-1-yl)thiophen-2-yl]-2H-triazol-4-amine?
The InChIKey is KVCBVQGJHVKXJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N4S/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)17-13-14-18(25-17)19-20(21)23-24-22-19/h9-11,13-14,16H,2-8,12H2,1H3,(H3,21,22,23,24).
What are the key properties of 5-[5-(4-octylcyclohexa-2,4-dien-1-yl)thiophen-2-yl]-2H-triazol-4-amine?
5-[5-(4-octylcyclohexa-2,4-dien-1-yl)thiophen-2-yl]-2H-triazol-4-amine has a molecular weight of 356.54 g/mol, XLogP of 5.84, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(4-octylcyclohexa-2,4-dien-1-yl)thiophen-2-yl]-2H-triazol-4-amine is sourced from PubChem (CID 170148087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).