C17H19N5O2 — CID 170148362
N-[4-(4,4-dimethyl-1-oxo-2,3-dihydroisoquinolin-6-yl)-5-methylpyrimidin-2-yl]-N-methylnitrous amide (PubChem CID 170148362) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[4-(4,4-dimethyl-1-oxo-2,3-dihydroisoquinolin-6-yl)-5-methylpyrimidin-2-yl]-N-methylnitrous amide.
| Compound Name | N-[4-(4,4-dimethyl-1-oxo-2,3-dihydroisoquinolin-6-yl)-5-methylpyrimidin-2-yl]-N-methylnitrous amide |
|---|---|
| PubChem CID | 170148362 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-[4-(4,4-dimethyl-1-oxo-2,3-dihydroisoquinolin-6-yl)-5-methylpyrimidin-2-yl]-N-methylnitrous amide |
| SMILES | Cc1cnc(N(C)N=O)nc1-c1ccc2c(c1)C(C)(C)CNC2=O |
| InChI | InChI=1S/C17H19N5O2/c1-10-8-18-16(22(4)21-24)20-14(10)11-5-6-12-13(7-11)17(2,3)9-19-15(12)23/h5-8H,9H2,1-4H3,(H,19,23) |
| InChIKey | CMQLGNUTLKOLDL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|