C23H29N5O4S — CID 170148529
N-[[1-[[3-(cyclohexylmethylsulfonylamino)-4-methyl-1,2-benzoxazol-6-yl]methyl]pyrazol-3-yl]methyl]prop-2-enamide (PubChem CID 170148529) has the molecular formula C23H29N5O4S and a molecular weight of 471.58 g/mol. Its IUPAC name is N-[[1-[[3-(cyclohexylmethylsulfonylamino)-4-methyl-1,2-benzoxazol-6-yl]methyl]pyrazol-3-yl]methyl]prop-2-enamide.
| Compound Name | N-[[1-[[3-(cyclohexylmethylsulfonylamino)-4-methyl-1,2-benzoxazol-6-yl]methyl]pyrazol-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 170148529 |
| Molecular Formula | C23H29N5O4S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | N-[[1-[[3-(cyclohexylmethylsulfonylamino)-4-methyl-1,2-benzoxazol-6-yl]methyl]pyrazol-3-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccn(Cc2cc(C)c3c(NS(=O)(=O)CC4CCCCC4)noc3c2)n1 |
| InChI | InChI=1S/C23H29N5O4S/c1-3-21(29)24-13-19-9-10-28(25-19)14-18-11-16(2)22-20(12-18)32-26-23(22)27-33(30,31)15-17-7-5-4-6-8-17/h3,9-12,17H,1,4-8,13-15H2,2H3,(H,24,29)(H,26,27) |
| InChIKey | GAIDWQVTJHGGEU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 119.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|