C24H23F2N2OPS — CID 170149719
1-[4-[2-[4-[difluoro(phosphanyl)methyl]-3-pyridinyl]phenyl]-2-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one (PubChem CID 170149719) has the molecular formula C24H23F2N2OPS and a molecular weight of 456.50 g/mol. Its IUPAC name is 1-[4-[2-[4-[difluoro(phosphanyl)methyl]-3-pyridinyl]phenyl]-2-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[2-[4-[difluoro(phosphanyl)methyl]-3-pyridinyl]phenyl]-2-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170149719 |
| Molecular Formula | C24H23F2N2OPS |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 1-[4-[2-[4-[difluoro(phosphanyl)methyl]-3-pyridinyl]phenyl]-2-ethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1Cc2sc(CC)cc2C(c2ccccc2-c2cnccc2C(F)(F)P)C1 |
| InChI | InChI=1S/C24H23F2N2OPS/c1-3-15-11-18-20(13-28(23(29)4-2)14-22(18)31-15)17-8-6-5-7-16(17)19-12-27-10-9-21(19)24(25,26)30/h4-12,20H,2-3,13-14,30H2,1H3 |
| InChIKey | AQMSLUFYBUOLAB-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|