C11H21NS — CID 170149972
(8Z)-4-propan-2-yl-3,4,5,6,7,10-hexahydro-2H-1,6-thiazecine (PubChem CID 170149972) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is (8Z)-4-propan-2-yl-3,4,5,6,7,10-hexahydro-2H-1,6-thiazecine.
| Compound Name | (8Z)-4-propan-2-yl-3,4,5,6,7,10-hexahydro-2H-1,6-thiazecine |
|---|---|
| PubChem CID | 170149972 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (8Z)-4-propan-2-yl-3,4,5,6,7,10-hexahydro-2H-1,6-thiazecine |
| SMILES | CC(C)C1CCSC/C=C\CNC1 |
| InChI | InChI=1S/C11H21NS/c1-10(2)11-5-8-13-7-4-3-6-12-9-11/h3-4,10-12H,5-9H2,1-2H3/b4-3- |
| InChIKey | MOROLHOOLARDKK-ARJAWSKDSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|