C11H21NO2 — CID 170149973
(5Z,7S,8S)-7,8-dimethoxy-2-methyl-2,3,4,7,8,9-hexahydro-1H-azonine (PubChem CID 170149973) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (5Z,7S,8S)-7,8-dimethoxy-2-methyl-2,3,4,7,8,9-hexahydro-1H-azonine.
| Compound Name | (5Z,7S,8S)-7,8-dimethoxy-2-methyl-2,3,4,7,8,9-hexahydro-1H-azonine |
|---|---|
| PubChem CID | 170149973 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (5Z,7S,8S)-7,8-dimethoxy-2-methyl-2,3,4,7,8,9-hexahydro-1H-azonine |
| SMILES | CO[C@H]1/C=C\CCC(C)NC[C@@H]1OC |
| InChI | InChI=1S/C11H21NO2/c1-9-6-4-5-7-10(13-2)11(14-3)8-12-9/h5,7,9-12H,4,6,8H2,1-3H3/b7-5-/t9?,10-,11-/m0/s1 |
| InChIKey | QKXWZRLABYLGPT-SEAMXJATSA-N |
| XLogP | 1.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|