C13H21N — CID 170150480
2,3-dimethyl-5-methylidenedeca-7,8,9-trien-2-amine (PubChem CID 170150480) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 2,3-dimethyl-5-methylidenedeca-7,8,9-trien-2-amine.
| Compound Name | 2,3-dimethyl-5-methylidenedeca-7,8,9-trien-2-amine |
|---|---|
| PubChem CID | 170150480 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 2,3-dimethyl-5-methylidenedeca-7,8,9-trien-2-amine |
| SMILES | C=C=C=CCC(=C)CC(C)C(C)(C)N |
| InChI | InChI=1S/C13H21N/c1-6-7-8-9-11(2)10-12(3)13(4,5)14/h8,12H,1-2,9-10,14H2,3-5H3 |
| InChIKey | NMVNEGIBUCTXNF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|