About 3-methyl-6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde
3-methyl-6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde (PubChem CID 170151195) has the molecular formula C20H31NO
and a molecular weight of 301.47 g/mol. Its IUPAC name is 3-methyl-6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde.
Molecular Properties
| Compound Name | 3-methyl-6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde |
| PubChem CID | 170151195 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | 3-methyl-6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde |
| SMILES | CCCCCCC(CC)c1ccc2c(c1)CC(C)CN2C=O |
| InChI | InChI=1S/C20H31NO/c1-4-6-7-8-9-17(5-2)18-10-11-20-19(13-18)12-16(3)14-21(20)15-22/h10-11,13,15-17H,4-9,12,14H2,1-3H3 |
| InChIKey | QDTGXEHPMASKLH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde?
The IUPAC name of 3-methyl-6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde (CID 170151195) is 3-methyl-6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde.
What is the SMILES notation for 3-methyl-6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde?
The canonical SMILES for 3-methyl-6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde is CCCCCCC(CC)c1ccc2c(c1)CC(C)CN2C=O.
What is the InChIKey of 3-methyl-6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde?
The InChIKey is QDTGXEHPMASKLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31NO/c1-4-6-7-8-9-17(5-2)18-10-11-20-19(13-18)12-16(3)14-21(20)15-22/h10-11,13,15-17H,4-9,12,14H2,1-3H3.
What are the key properties of 3-methyl-6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde?
3-methyl-6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde has a molecular weight of 301.47 g/mol, XLogP of 5.31, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde is sourced from PubChem (CID 170151195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).