About 6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde
6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde (PubChem CID 170151197) has the molecular formula C19H29NO
and a molecular weight of 287.45 g/mol. Its IUPAC name is 6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde.
Molecular Properties
| Compound Name | 6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde |
| PubChem CID | 170151197 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde |
| SMILES | CCCCCCC(CC)c1ccc2c(c1)CCCN2C=O |
| InChI | InChI=1S/C19H29NO/c1-3-5-6-7-9-16(4-2)17-11-12-19-18(14-17)10-8-13-20(19)15-21/h11-12,14-16H,3-10,13H2,1-2H3 |
| InChIKey | YCVITTUYNNLTNR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde?
The IUPAC name of 6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde (CID 170151197) is 6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde.
What is the SMILES notation for 6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde?
The canonical SMILES for 6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde is CCCCCCC(CC)c1ccc2c(c1)CCCN2C=O.
What is the InChIKey of 6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde?
The InChIKey is YCVITTUYNNLTNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO/c1-3-5-6-7-9-16(4-2)17-11-12-19-18(14-17)10-8-13-20(19)15-21/h11-12,14-16H,3-10,13H2,1-2H3.
What are the key properties of 6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde?
6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde has a molecular weight of 287.45 g/mol, XLogP of 5.06, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nonan-3-yl-3,4-dihydro-2H-quinoline-1-carbaldehyde is sourced from PubChem (CID 170151197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).