C22H29F6NO3 — CID 170151280
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2Z,4E,6E,7Z)-4,6-di(ethylidene)-5-hydroxynona-2,7-dien-5-yl]piperidine-1-carboxylate (PubChem CID 170151280) has the molecular formula C22H29F6NO3 and a molecular weight of 469.47 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2Z,4E,6E,7Z)-4,6-di(ethylidene)-5-hydroxynona-2,7-dien-5-yl]piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2Z,4E,6E,7Z)-4,6-di(ethylidene)-5-hydroxynona-2,7-dien-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170151280 |
| Molecular Formula | C22H29F6NO3 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2Z,4E,6E,7Z)-4,6-di(ethylidene)-5-hydroxynona-2,7-dien-5-yl]piperidine-1-carboxylate |
| SMILES | C/C=C\C(=C/C)C(O)(C(/C=C\C)=C/C)C1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H29F6NO3/c1-5-9-15(7-3)20(31,16(8-4)10-6-2)17-11-13-29(14-12-17)19(30)32-18(21(23,24)25)22(26,27)28/h5-10,17-18,31H,11-14H2,1-4H3/b9-5-,10-6-,15-7+,16-8+ |
| InChIKey | SIOOUUVXDTXSCO-XMAQFEIXSA-N |
| XLogP | 6.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|