C25H31F6NO3 — CID 170151291
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(3Z,5E,7E,8Z)-5,7-di(ethylidene)-6-methoxyundeca-1,3,8,10-tetraen-6-yl]piperidine-1-carboxylate (PubChem CID 170151291) has the molecular formula C25H31F6NO3 and a molecular weight of 507.52 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(3Z,5E,7E,8Z)-5,7-di(ethylidene)-6-methoxyundeca-1,3,8,10-tetraen-6-yl]piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(3Z,5E,7E,8Z)-5,7-di(ethylidene)-6-methoxyundeca-1,3,8,10-tetraen-6-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170151291 |
| Molecular Formula | C25H31F6NO3 |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(3Z,5E,7E,8Z)-5,7-di(ethylidene)-6-methoxyundeca-1,3,8,10-tetraen-6-yl]piperidine-1-carboxylate |
| SMILES | C=C/C=C\C(=C/C)C(OC)(C(/C=C\C=C)=C/C)C1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C25H31F6NO3/c1-6-10-12-18(8-3)23(34-5,19(9-4)13-11-7-2)20-14-16-32(17-15-20)22(33)35-21(24(26,27)28)25(29,30)31/h6-13,20-21H,1-2,14-17H2,3-5H3/b12-10-,13-11-,18-8+,19-9+ |
| InChIKey | LVUFFOCADOMFRF-YVKAORIXSA-N |
| XLogP | 7.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|