C11H23NO4 — CID 170151294
tert-butyl 3-(2-amino-3-hydroxy-2-methylpropoxy)propanoate (PubChem CID 170151294) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is tert-butyl 3-(2-amino-3-hydroxy-2-methylpropoxy)propanoate.
| Compound Name | tert-butyl 3-(2-amino-3-hydroxy-2-methylpropoxy)propanoate |
|---|---|
| PubChem CID | 170151294 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | tert-butyl 3-(2-amino-3-hydroxy-2-methylpropoxy)propanoate |
| SMILES | CC(N)(CO)COCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H23NO4/c1-10(2,3)16-9(14)5-6-15-8-11(4,12)7-13/h13H,5-8,12H2,1-4H3 |
| InChIKey | JYTSRKZOCXLWTM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|