About 1-oxo-3,3-diphenyl-N-(1,3-thiazol-2-yl)-4H-isochromene-6-carboxamide
1-oxo-3,3-diphenyl-N-(1,3-thiazol-2-yl)-4H-isochromene-6-carboxamide (PubChem CID 17015155) has the molecular formula C25H18N2O3S
and a molecular weight of 426.50 g/mol. Its IUPAC name is 1-oxo-3,3-diphenyl-N-(1,3-thiazol-2-yl)-4H-isochromene-6-carboxamide.
Molecular Properties
| Compound Name | 1-oxo-3,3-diphenyl-N-(1,3-thiazol-2-yl)-4H-isochromene-6-carboxamide |
| PubChem CID | 17015155 |
| Molecular Formula | C25H18N2O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 1-oxo-3,3-diphenyl-N-(1,3-thiazol-2-yl)-4H-isochromene-6-carboxamide |
| SMILES | O=C(Nc1nccs1)c1ccc2c(c1)CC(c1ccccc1)(c1ccccc1)OC2=O |
| InChI | InChI=1S/C25H18N2O3S/c28-22(27-24-26-13-14-31-24)17-11-12-21-18(15-17)16-25(30-23(21)29,19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-15H,16H2,(H,26,27,28) |
| InChIKey | JLTQXBBGHJALMF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-oxo-3,3-diphenyl-N-(1,3-thiazol-2-yl)-4H-isochromene-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-3,3-diphenyl-N-(1,3-thiazol-2-yl)-4H-isochromene-6-carboxamide?
The IUPAC name of 1-oxo-3,3-diphenyl-N-(1,3-thiazol-2-yl)-4H-isochromene-6-carboxamide (CID 17015155) is 1-oxo-3,3-diphenyl-N-(1,3-thiazol-2-yl)-4H-isochromene-6-carboxamide.
What is the SMILES notation for 1-oxo-3,3-diphenyl-N-(1,3-thiazol-2-yl)-4H-isochromene-6-carboxamide?
The canonical SMILES for 1-oxo-3,3-diphenyl-N-(1,3-thiazol-2-yl)-4H-isochromene-6-carboxamide is O=C(Nc1nccs1)c1ccc2c(c1)CC(c1ccccc1)(c1ccccc1)OC2=O.
What is the InChIKey of 1-oxo-3,3-diphenyl-N-(1,3-thiazol-2-yl)-4H-isochromene-6-carboxamide?
The InChIKey is JLTQXBBGHJALMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18N2O3S/c28-22(27-24-26-13-14-31-24)17-11-12-21-18(15-17)16-25(30-23(21)29,19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-15H,16H2,(H,26,27,28).
What are the key properties of 1-oxo-3,3-diphenyl-N-(1,3-thiazol-2-yl)-4H-isochromene-6-carboxamide?
1-oxo-3,3-diphenyl-N-(1,3-thiazol-2-yl)-4H-isochromene-6-carboxamide has a molecular weight of 426.50 g/mol, XLogP of 5.05, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-3,3-diphenyl-N-(1,3-thiazol-2-yl)-4H-isochromene-6-carboxamide is sourced from PubChem (CID 17015155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).