C19H22N3O2P — CID 170151570
4-(3,7-dimethylimidazo[1,2-a]pyridin-2-yl)-3-methoxy-N,2-dimethyl-5-phosphanylbenzamide (PubChem CID 170151570) has the molecular formula C19H22N3O2P and a molecular weight of 355.38 g/mol. Its IUPAC name is 4-(3,7-dimethylimidazo[1,2-a]pyridin-2-yl)-3-methoxy-N,2-dimethyl-5-phosphanylbenzamide.
| Compound Name | 4-(3,7-dimethylimidazo[1,2-a]pyridin-2-yl)-3-methoxy-N,2-dimethyl-5-phosphanylbenzamide |
|---|---|
| PubChem CID | 170151570 |
| Molecular Formula | C19H22N3O2P |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 4-(3,7-dimethylimidazo[1,2-a]pyridin-2-yl)-3-methoxy-N,2-dimethyl-5-phosphanylbenzamide |
| SMILES | CNC(=O)c1cc(P)c(-c2nc3cc(C)ccn3c2C)c(OC)c1C |
| InChI | InChI=1S/C19H22N3O2P/c1-10-6-7-22-12(3)17(21-15(22)8-10)16-14(25)9-13(19(23)20-4)11(2)18(16)24-5/h6-9H,25H2,1-5H3,(H,20,23) |
| InChIKey | AFAUHFRGWCZYJL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|