About 4-[3-chloro-4-[[(3S)-3,4-dimethylpiperazin-1-yl]methyl]phenyl]morpholine
4-[3-chloro-4-[[(3S)-3,4-dimethylpiperazin-1-yl]methyl]phenyl]morpholine (PubChem CID 170151694) has the molecular formula C17H26ClN3O
and a molecular weight of 323.87 g/mol. Its IUPAC name is 4-[3-chloro-4-[[(3S)-3,4-dimethylpiperazin-1-yl]methyl]phenyl]morpholine.
Molecular Properties
| Compound Name | 4-[3-chloro-4-[[(3S)-3,4-dimethylpiperazin-1-yl]methyl]phenyl]morpholine |
| PubChem CID | 170151694 |
| Molecular Formula | C17H26ClN3O |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 4-[3-chloro-4-[[(3S)-3,4-dimethylpiperazin-1-yl]methyl]phenyl]morpholine |
| SMILES | C[C@H]1CN(Cc2ccc(N3CCOCC3)cc2Cl)CCN1C |
| InChI | InChI=1S/C17H26ClN3O/c1-14-12-20(6-5-19(14)2)13-15-3-4-16(11-17(15)18)21-7-9-22-10-8-21/h3-4,11,14H,5-10,12-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | HJSODIBGGTXDRH-AWEZNQCLSA-N |
| XLogP | 2.31 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-chloro-4-[[(3S)-3,4-dimethylpiperazin-1-yl]methyl]phenyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-chloro-4-[[(3S)-3,4-dimethylpiperazin-1-yl]methyl]phenyl]morpholine?
The IUPAC name of 4-[3-chloro-4-[[(3S)-3,4-dimethylpiperazin-1-yl]methyl]phenyl]morpholine (CID 170151694) is 4-[3-chloro-4-[[(3S)-3,4-dimethylpiperazin-1-yl]methyl]phenyl]morpholine.
What is the SMILES notation for 4-[3-chloro-4-[[(3S)-3,4-dimethylpiperazin-1-yl]methyl]phenyl]morpholine?
The canonical SMILES for 4-[3-chloro-4-[[(3S)-3,4-dimethylpiperazin-1-yl]methyl]phenyl]morpholine is C[C@H]1CN(Cc2ccc(N3CCOCC3)cc2Cl)CCN1C.
What is the InChIKey of 4-[3-chloro-4-[[(3S)-3,4-dimethylpiperazin-1-yl]methyl]phenyl]morpholine?
The InChIKey is HJSODIBGGTXDRH-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H26ClN3O/c1-14-12-20(6-5-19(14)2)13-15-3-4-16(11-17(15)18)21-7-9-22-10-8-21/h3-4,11,14H,5-10,12-13H2,1-2H3/t14-/m0/s1.
What are the key properties of 4-[3-chloro-4-[[(3S)-3,4-dimethylpiperazin-1-yl]methyl]phenyl]morpholine?
4-[3-chloro-4-[[(3S)-3,4-dimethylpiperazin-1-yl]methyl]phenyl]morpholine has a molecular weight of 323.87 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-chloro-4-[[(3S)-3,4-dimethylpiperazin-1-yl]methyl]phenyl]morpholine is sourced from PubChem (CID 170151694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).